About (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine
(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 94804094) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Analyze (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 94804094) is (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is C[C@H]1CNc2cc(F)ccc2O1.
What is the InChIKey of (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is AMTHYOLDKMTOCX-LURJTMIESA-N. The full InChI is InChI=1S/C9H10FNO/c1-6-5-11-8-4-7(10)2-3-9(8)12-6/h2-4,6,11H,5H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine?
(2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 167.18 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 94804094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).