C11H16N2O — CID 82059310
N-ethyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine (PubChem CID 82059310) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-ethyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine.
| Compound Name | N-ethyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 82059310 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-ethyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
| SMILES | CCNc1ccc2c(c1)NCC(C)O2 |
| InChI | InChI=1S/C11H16N2O/c1-3-12-9-4-5-11-10(6-9)13-7-8(2)14-11/h4-6,8,12-13H,3,7H2,1-2H3 |
| InChIKey | FPOUTFZXMDTPEB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|