C15H14BrNO — CID 116817485
6-(2-bromophenyl)-2-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116817485) has the molecular formula C15H14BrNO and a molecular weight of 304.19 g/mol. Its IUPAC name is 6-(2-bromophenyl)-2-methyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-(2-bromophenyl)-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116817485 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 6-(2-bromophenyl)-2-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC1CNc2cc(-c3ccccc3Br)ccc2O1 |
| InChI | InChI=1S/C15H14BrNO/c1-10-9-17-14-8-11(6-7-15(14)18-10)12-4-2-3-5-13(12)16/h2-8,10,17H,9H2,1H3 |
| InChIKey | FUNFEMJNNIJURG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |