C11H15NO — CID 82229720
2,6,7-trimethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82229720) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,6,7-trimethyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2,6,7-trimethyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82229720 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2,6,7-trimethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1cc2c(cc1C)OC(C)CN2 |
| InChI | InChI=1S/C11H15NO/c1-7-4-10-11(5-8(7)2)13-9(3)6-12-10/h4-5,9,12H,6H2,1-3H3 |
| InChIKey | PMHFVGOMMKOMNO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |