About 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine
6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine (PubChem CID 82229801) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
| PubChem CID | 82229801 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
| SMILES | CC1CNc2cc(F)cc(N)c2O1 |
| InChI | InChI=1S/C9H11FN2O/c1-5-4-12-8-3-6(10)2-7(11)9(8)13-5/h2-3,5,12H,4,11H2,1H3 |
| InChIKey | ARLBTURZEXASFO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The IUPAC name of 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine (CID 82229801) is 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine.
What is the SMILES notation for 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The canonical SMILES for 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine is CC1CNc2cc(F)cc(N)c2O1.
What is the InChIKey of 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The InChIKey is ARLBTURZEXASFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c1-5-4-12-8-3-6(10)2-7(11)9(8)13-5/h2-3,5,12H,4,11H2,1H3.
What are the key properties of 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine has a molecular weight of 182.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine is sourced from PubChem (CID 82229801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).