C9H11FN2O — CID 82229802
8-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine (PubChem CID 82229802) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 8-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine.
| Compound Name | 8-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 82229802 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 8-fluoro-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
| SMILES | CC1CNc2cc(N)cc(F)c2O1 |
| InChI | InChI=1S/C9H11FN2O/c1-5-4-12-8-3-6(11)2-7(10)9(8)13-5/h2-3,5,12H,4,11H2,1H3 |
| InChIKey | FCBPHBJAAAMQES-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|