C12H14FNO — CID 84620880
7-fluoro-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine (PubChem CID 84620880) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 7-fluoro-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine.
| Compound Name | 7-fluoro-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
|---|---|
| PubChem CID | 84620880 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 7-fluoro-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
| SMILES | Fc1ccc2c(c1)OC1CCCCC1N2 |
| InChI | InChI=1S/C12H14FNO/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h5-7,9,11,14H,1-4H2 |
| InChIKey | NVXOWWTWPJERRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |