C14H19NO — CID 115825603
1-methyl-5a,6,7,8,9,10,10a,11-octahydrocyclohepta[b][1,4]benzoxazine (PubChem CID 115825603) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-methyl-5a,6,7,8,9,10,10a,11-octahydrocyclohepta[b][1,4]benzoxazine.
| Compound Name | 1-methyl-5a,6,7,8,9,10,10a,11-octahydrocyclohepta[b][1,4]benzoxazine |
|---|---|
| PubChem CID | 115825603 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-methyl-5a,6,7,8,9,10,10a,11-octahydrocyclohepta[b][1,4]benzoxazine |
| SMILES | Cc1cccc2c1NC1CCCCCC1O2 |
| InChI | InChI=1S/C14H19NO/c1-10-6-5-9-13-14(10)15-11-7-3-2-4-8-12(11)16-13/h5-6,9,11-12,15H,2-4,7-8H2,1H3 |
| InChIKey | IZGGKHGIZGRZKS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |