C13H15NO3 — CID 84627452
6,7,8,9,9a,10-hexahydro-5aH-phenoxazine-4-carboxylic acid (PubChem CID 84627452) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 6,7,8,9,9a,10-hexahydro-5aH-phenoxazine-4-carboxylic acid.
| Compound Name | 6,7,8,9,9a,10-hexahydro-5aH-phenoxazine-4-carboxylic acid |
|---|---|
| PubChem CID | 84627452 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6,7,8,9,9a,10-hexahydro-5aH-phenoxazine-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OC1CCCCC1N2 |
| InChI | InChI=1S/C13H15NO3/c15-13(16)8-4-3-6-10-12(8)17-11-7-2-1-5-9(11)14-10/h3-4,6,9,11,14H,1-2,5,7H2,(H,15,16) |
| InChIKey | OZROBBLFGMSQDZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |