C8H7ClINO — CID 166788539
(3S)-7-chloro-3-iodo-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 166788539) has the molecular formula C8H7ClINO and a molecular weight of 295.51 g/mol. Its IUPAC name is (3S)-7-chloro-3-iodo-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | (3S)-7-chloro-3-iodo-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 166788539 |
| Molecular Formula | C8H7ClINO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | (3S)-7-chloro-3-iodo-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Clc1ccc2c(c1)OC[C@H](I)N2 |
| InChI | InChI=1S/C8H7ClINO/c9-5-1-2-6-7(3-5)12-4-8(10)11-6/h1-3,8,11H,4H2/t8-/m1/s1 |
| InChIKey | MUQIJMVTKZTJDM-MRVPVSSYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|