C14H11Cl2NO — CID 101467783
7-chloro-3-(3-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 101467783) has the molecular formula C14H11Cl2NO and a molecular weight of 280.15 g/mol. Its IUPAC name is 7-chloro-3-(3-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 7-chloro-3-(3-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 101467783 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 7-chloro-3-(3-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Clc1cccc(C2COc3cc(Cl)ccc3N2)c1 |
| InChI | InChI=1S/C14H11Cl2NO/c15-10-3-1-2-9(6-10)13-8-18-14-7-11(16)4-5-12(14)17-13/h1-7,13,17H,8H2 |
| InChIKey | WUTPZPKTZDEKAA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |