C14H10Cl3N — CID 4621294
4,6-dichloro-2-(3-chlorophenyl)-2,3-dihydro-1H-indole (PubChem CID 4621294) has the molecular formula C14H10Cl3N and a molecular weight of 298.60 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-chlorophenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4,6-dichloro-2-(3-chlorophenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4621294 |
| Molecular Formula | C14H10Cl3N |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4,6-dichloro-2-(3-chlorophenyl)-2,3-dihydro-1H-indole |
| SMILES | Clc1cccc(C2Cc3c(Cl)cc(Cl)cc3N2)c1 |
| InChI | InChI=1S/C14H10Cl3N/c15-9-3-1-2-8(4-9)13-7-11-12(17)5-10(16)6-14(11)18-13/h1-6,13,18H,7H2 |
| InChIKey | SHXBOGGATMPGCV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |