C15H15BrClFN2 — CID 156855813
4-bromo-5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1H-indole;methanamine (PubChem CID 156855813) has the molecular formula C15H15BrClFN2 and a molecular weight of 357.65 g/mol. Its IUPAC name is 4-bromo-5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1H-indole;methanamine.
| Compound Name | 4-bromo-5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1H-indole;methanamine |
|---|---|
| PubChem CID | 156855813 |
| Molecular Formula | C15H15BrClFN2 |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4-bromo-5-chloro-6-fluoro-2-phenyl-2,3-dihydro-1H-indole;methanamine |
| SMILES | CN.Fc1cc2c(c(Br)c1Cl)CC(c1ccccc1)N2 |
| InChI | InChI=1S/C14H10BrClFN.CH5N/c15-13-9-6-11(8-4-2-1-3-5-8)18-12(9)7-10(17)14(13)16;1-2/h1-5,7,11,18H,6H2;2H2,1H3 |
| InChIKey | SJXRPWSRJDPCJF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|