C16H15F2N — CID 5240308
2-(3,4-difluorophenyl)-4,6-dimethyl-2,3-dihydro-1H-indole (PubChem CID 5240308) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-4,6-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | 2-(3,4-difluorophenyl)-4,6-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 5240308 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-4,6-dimethyl-2,3-dihydro-1H-indole |
| SMILES | Cc1cc(C)c2c(c1)NC(c1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C16H15F2N/c1-9-5-10(2)12-8-15(19-16(12)6-9)11-3-4-13(17)14(18)7-11/h3-7,15,19H,8H2,1-2H3 |
| InChIKey | CFILFEGPOMDMTD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |