C12H17N — CID 95427024
(2R)-2,5,7-trimethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 95427024) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (2R)-2,5,7-trimethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R)-2,5,7-trimethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 95427024 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R)-2,5,7-trimethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc(C)c2c(c1)N[C@H](C)CC2 |
| InChI | InChI=1S/C12H17N/c1-8-6-9(2)11-5-4-10(3)13-12(11)7-8/h6-7,10,13H,4-5H2,1-3H3/t10-/m1/s1 |
| InChIKey | HXQRWDSVQPKXGJ-SNVBAGLBSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |