C11H13NO — CID 82213232
5,7-dimethyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82213232) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5,7-dimethyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5,7-dimethyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82213232 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5,7-dimethyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C11H13NO/c1-7-5-8(2)9-3-4-11(13)12-10(9)6-7/h5-6H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | AZIJCJZEQGVEAS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |