C9H6BrF2NO — CID 176884703
6-bromo-5,7-difluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 176884703) has the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. Its IUPAC name is 6-bromo-5,7-difluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-bromo-5,7-difluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 176884703 |
| Molecular Formula | C9H6BrF2NO |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 6-bromo-5,7-difluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(cc(F)c(Br)c2F)N1 |
| InChI | InChI=1S/C9H6BrF2NO/c10-8-5(11)3-6-4(9(8)12)1-2-7(14)13-6/h3H,1-2H2,(H,13,14) |
| InChIKey | FDSRRTIXPLIKAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|