C10H11FN2O — CID 145472330
7-(aminomethyl)-5-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 145472330) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 7-(aminomethyl)-5-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(aminomethyl)-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145472330 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 7-(aminomethyl)-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NCc1cc(F)c2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C10H11FN2O/c11-8-3-6(5-12)4-9-7(8)1-2-10(14)13-9/h3-4H,1-2,5,12H2,(H,13,14) |
| InChIKey | VEXQEBNIEGHZQT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |