C11H7F6NO — CID 82213230
5,7-bis(trifluoromethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82213230) has the molecular formula C11H7F6NO and a molecular weight of 283.17 g/mol. Its IUPAC name is 5,7-bis(trifluoromethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5,7-bis(trifluoromethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82213230 |
| Molecular Formula | C11H7F6NO |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 5,7-bis(trifluoromethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(cc(C(F)(F)F)cc2C(F)(F)F)N1 |
| InChI | InChI=1S/C11H7F6NO/c12-10(13,14)5-3-7(11(15,16)17)6-1-2-9(19)18-8(6)4-5/h3-4H,1-2H2,(H,18,19) |
| InChIKey | AYWWKIPKFKPVAM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |