C9H8F3N3O — CID 6425616
5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 6425616) has the molecular formula C9H8F3N3O and a molecular weight of 231.18 g/mol. Its IUPAC name is 5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 6425616 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | Nc1cc(C(F)(F)F)cc2c1NCC(=O)N2 |
| InChI | InChI=1S/C9H8F3N3O/c10-9(11,12)4-1-5(13)8-6(2-4)15-7(16)3-14-8/h1-2,14H,3,13H2,(H,15,16) |
| InChIKey | ZQOUJLMZBNUEPM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|