C7H4F5NO — CID 130097113
6-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 130097113) has the molecular formula C7H4F5NO and a molecular weight of 213.11 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130097113 |
| Molecular Formula | C7H4F5NO |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 6-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)cc(C(F)F)[nH]1 |
| InChI | InChI=1S/C7H4F5NO/c8-6(9)4-1-3(7(10,11)12)2-5(14)13-4/h1-2,6H,(H,13,14) |
| InChIKey | WQSQQOYCTJDZOK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |