C13H7F6NO — CID 106516768
4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]-1H-pyridin-2-one (PubChem CID 106516768) has the molecular formula C13H7F6NO and a molecular weight of 307.19 g/mol. Its IUPAC name is 4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]-1H-pyridin-2-one.
| Compound Name | 4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106516768 |
| Molecular Formula | C13H7F6NO |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-(trifluoromethyl)-6-[2-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)cc(-c2ccccc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C13H7F6NO/c14-12(15,16)7-5-10(20-11(21)6-7)8-3-1-2-4-9(8)13(17,18)19/h1-6H,(H,20,21) |
| InChIKey | SZSHCXKOOUBXIX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |