C10H6F3NOS — CID 43286788
4-[2-(trifluoromethyl)phenyl]-3H-1,3-thiazol-2-one (PubChem CID 43286788) has the molecular formula C10H6F3NOS and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)phenyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[2-(trifluoromethyl)phenyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 43286788 |
| Molecular Formula | C10H6F3NOS |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 4-[2-(trifluoromethyl)phenyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2ccccc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C10H6F3NOS/c11-10(12,13)7-4-2-1-3-6(7)8-5-16-9(15)14-8/h1-5H,(H,14,15) |
| InChIKey | HFWMMQIUVAIEDE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |