C12H6F5NO — CID 106517237
6-(2,5-difluorophenyl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 106517237) has the molecular formula C12H6F5NO and a molecular weight of 275.18 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(2,5-difluorophenyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106517237 |
| Molecular Formula | C12H6F5NO |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 6-(2,5-difluorophenyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)cc(-c2cc(F)ccc2F)[nH]1 |
| InChI | InChI=1S/C12H6F5NO/c13-7-1-2-9(14)8(5-7)10-3-6(12(15,16)17)4-11(19)18-10/h1-5H,(H,18,19) |
| InChIKey | GGDQHPFCMCMEFG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |