C12H5F6NS — CID 106520196
4-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)-1H-pyridine-2-thione (PubChem CID 106520196) has the molecular formula C12H5F6NS and a molecular weight of 309.23 g/mol. Its IUPAC name is 4-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)-1H-pyridine-2-thione.
| Compound Name | 4-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106520196 |
| Molecular Formula | C12H5F6NS |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)-1H-pyridine-2-thione |
| SMILES | Fc1cc(F)c(-c2cc(C(F)(F)F)cc(=S)[nH]2)cc1F |
| InChI | InChI=1S/C12H5F6NS/c13-7-4-9(15)8(14)3-6(7)10-1-5(12(16,17)18)2-11(20)19-10/h1-4H,(H,19,20) |
| InChIKey | XRGGFAIWQKMNOY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|