C12H6F5NS — CID 106518206
6-(2,3-difluorophenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione (PubChem CID 106518206) has the molecular formula C12H6F5NS and a molecular weight of 291.24 g/mol. Its IUPAC name is 6-(2,3-difluorophenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione.
| Compound Name | 6-(2,3-difluorophenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 106518206 |
| Molecular Formula | C12H6F5NS |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 6-(2,3-difluorophenyl)-4-(trifluoromethyl)-1H-pyridine-2-thione |
| SMILES | Fc1cccc(-c2cc(C(F)(F)F)cc(=S)[nH]2)c1F |
| InChI | InChI=1S/C12H6F5NS/c13-8-3-1-2-7(11(8)14)9-4-6(12(15,16)17)5-10(19)18-9/h1-5H,(H,18,19) |
| InChIKey | RZSXLUBRFILWID-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|