C11H6F3NS — CID 106520198
2-(2,4,5-trifluorophenyl)-1H-pyridine-4-thione (PubChem CID 106520198) has the molecular formula C11H6F3NS and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(2,4,5-trifluorophenyl)-1H-pyridine-4-thione.
| Compound Name | 2-(2,4,5-trifluorophenyl)-1H-pyridine-4-thione |
|---|---|
| PubChem CID | 106520198 |
| Molecular Formula | C11H6F3NS |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(2,4,5-trifluorophenyl)-1H-pyridine-4-thione |
| SMILES | Fc1cc(F)c(-c2cc(=S)cc[nH]2)cc1F |
| InChI | InChI=1S/C11H6F3NS/c12-8-5-10(14)9(13)4-7(8)11-3-6(16)1-2-15-11/h1-5H,(H,15,16) |
| InChIKey | SHKBOQWMHSUANH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|