C10H5F3N2S — CID 106520230
4-(2,4,5-trifluorophenyl)-1H-pyridazine-6-thione (PubChem CID 106520230) has the molecular formula C10H5F3N2S and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-(2,4,5-trifluorophenyl)-1H-pyridazine-6-thione.
| Compound Name | 4-(2,4,5-trifluorophenyl)-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 106520230 |
| Molecular Formula | C10H5F3N2S |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-(2,4,5-trifluorophenyl)-1H-pyridazine-6-thione |
| SMILES | Fc1cc(F)c(-c2cn[nH]c(=S)c2)cc1F |
| InChI | InChI=1S/C10H5F3N2S/c11-7-3-9(13)8(12)2-6(7)5-1-10(16)15-14-4-5/h1-4H,(H,15,16) |
| InChIKey | IOEFJVFFEHKOQG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|