C15H10BrF2NO — CID 101479515
6-bromo-5,7-difluoro-4-phenyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 101479515) has the molecular formula C15H10BrF2NO and a molecular weight of 338.15 g/mol. Its IUPAC name is 6-bromo-5,7-difluoro-4-phenyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-bromo-5,7-difluoro-4-phenyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 101479515 |
| Molecular Formula | C15H10BrF2NO |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 6-bromo-5,7-difluoro-4-phenyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(c2ccccc2)c2c(cc(F)c(Br)c2F)N1 |
| InChI | InChI=1S/C15H10BrF2NO/c16-14-10(17)7-11-13(15(14)18)9(6-12(20)19-11)8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,19,20) |
| InChIKey | RVTNODTWHCUKCN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|