C17H18BrNO — CID 91416238
6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one;ethane (PubChem CID 91416238) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one;ethane.
| Compound Name | 6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one;ethane |
|---|---|
| PubChem CID | 91416238 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one;ethane |
| SMILES | CC.O=C1CC(c2ccccc2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C15H12BrNO.C2H6/c16-11-6-7-14-13(8-11)12(9-15(18)17-14)10-4-2-1-3-5-10;1-2/h1-8,12H,9H2,(H,17,18);1-2H3 |
| InChIKey | PVBDGLYILWMNBW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |