C13H11NOS — CID 42559090
(7S)-7-phenyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 42559090) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is (7S)-7-phenyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7S)-7-phenyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 42559090 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (7S)-7-phenyl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | O=C1C[C@@H](c2ccccc2)c2sccc2N1 |
| InChI | InChI=1S/C13H11NOS/c15-12-8-10(9-4-2-1-3-5-9)13-11(14-12)6-7-16-13/h1-7,10H,8H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | YAEKGVLVGODGHI-JTQLQIEISA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |