About (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one
(7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 42553733) has the molecular formula C11H9NOS2
and a molecular weight of 235.33 g/mol. Its IUPAC name is (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| PubChem CID | 42553733 |
| Molecular Formula | C11H9NOS2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | O=C1C[C@@H](c2ccsc2)c2sccc2N1 |
| InChI | InChI=1S/C11H9NOS2/c13-10-5-8(7-1-3-14-6-7)11-9(12-10)2-4-15-11/h1-4,6,8H,5H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | ZDOXSXRZKHLDPU-QMMMGPOBSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one?
The IUPAC name of (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (CID 42553733) is (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
What is the SMILES notation for (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one?
The canonical SMILES for (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one is O=C1C[C@@H](c2ccsc2)c2sccc2N1.
What is the InChIKey of (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one?
The InChIKey is ZDOXSXRZKHLDPU-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H9NOS2/c13-10-5-8(7-1-3-14-6-7)11-9(12-10)2-4-15-11/h1-4,6,8H,5H2,(H,12,13)/t8-/m0/s1.
What are the key properties of (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one?
(7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one has a molecular weight of 235.33 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-thiophen-3-yl-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one is sourced from PubChem (CID 42553733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).