C9H7BrFNO — CID 130051331
8-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 130051331) has the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. Its IUPAC name is 8-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 130051331 |
| Molecular Formula | C9H7BrFNO |
| Molecular Weight | 244.06 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 8-bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(F)ccc(Br)c2N1 |
| InChI | InChI=1S/C9H7BrFNO/c10-6-2-3-7(11)5-1-4-8(13)12-9(5)6/h2-3H,1,4H2,(H,12,13) |
| InChIKey | AIZZHYOWBGTZNA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |