C11H10FNO3 — CID 151634733
(8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-5-yl) acetate (PubChem CID 151634733) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is (8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-5-yl) acetate.
| Compound Name | (8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-5-yl) acetate |
|---|---|
| PubChem CID | 151634733 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (8-fluoro-2-oxo-3,4-dihydro-1H-quinolin-5-yl) acetate |
| SMILES | CC(=O)Oc1ccc(F)c2c1CCC(=O)N2 |
| InChI | InChI=1S/C11H10FNO3/c1-6(14)16-9-4-3-8(12)11-7(9)2-5-10(15)13-11/h3-4H,2,5H2,1H3,(H,13,15) |
| InChIKey | QRGKTJUKYRLCLF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|