C10H9ClFNO2 — CID 118905232
8-chloro-7-fluoro-5-methoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 118905232) has the molecular formula C10H9ClFNO2 and a molecular weight of 229.64 g/mol. Its IUPAC name is 8-chloro-7-fluoro-5-methoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-chloro-7-fluoro-5-methoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118905232 |
| Molecular Formula | C10H9ClFNO2 |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 8-chloro-7-fluoro-5-methoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc(F)c(Cl)c2c1CCC(=O)N2 |
| InChI | InChI=1S/C10H9ClFNO2/c1-15-7-4-6(12)9(11)10-5(7)2-3-8(14)13-10/h4H,2-3H2,1H3,(H,13,14) |
| InChIKey | HJUYEWHVEWFHGB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |