C10H7BrFNO — CID 130049276
4-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 130049276) has the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. Its IUPAC name is 4-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 4-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 130049276 |
| Molecular Formula | C10H7BrFNO |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 4-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2c(F)ccc(Br)c2C12CC2 |
| InChI | InChI=1S/C10H7BrFNO/c11-5-1-2-6(12)8-7(5)10(3-4-10)9(14)13-8/h1-2H,3-4H2,(H,13,14) |
| InChIKey | YXWWDGGNVAWAAT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |