C17H22N2O2 — CID 13324478
9-(ethylaminomethyl)-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione (PubChem CID 13324478) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 9-(ethylaminomethyl)-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione.
| Compound Name | 9-(ethylaminomethyl)-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
|---|---|
| PubChem CID | 13324478 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 9-(ethylaminomethyl)-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione |
| SMILES | CCNCC1CCc2c(C)cc3c(c2C1=O)CCC(=O)N3 |
| InChI | InChI=1S/C17H22N2O2/c1-3-18-9-11-4-5-12-10(2)8-14-13(16(12)17(11)21)6-7-15(20)19-14/h8,11,18H,3-7,9H2,1-2H3,(H,19,20) |
| InChIKey | MXGSWYARJSXBTF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |