C10H7F2N3O — CID 116980021
4-(3,4-difluorophenyl)-2-oxoimidazolidine-1-carbonitrile (PubChem CID 116980021) has the molecular formula C10H7F2N3O and a molecular weight of 223.18 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-oxoimidazolidine-1-carbonitrile.
| Compound Name | 4-(3,4-difluorophenyl)-2-oxoimidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 116980021 |
| Molecular Formula | C10H7F2N3O |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-oxoimidazolidine-1-carbonitrile |
| SMILES | N#CN1CC(c2ccc(F)c(F)c2)NC1=O |
| InChI | InChI=1S/C10H7F2N3O/c11-7-2-1-6(3-8(7)12)9-4-15(5-13)10(16)14-9/h1-3,9H,4H2,(H,14,16) |
| InChIKey | LYVINBSCEFGSQG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|