C18H18F2N2O — CID 59975359
4-(3,4-difluorophenyl)-1-[(1R)-1-phenylethyl]-1,3-diazinan-2-one (PubChem CID 59975359) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1-[(1R)-1-phenylethyl]-1,3-diazinan-2-one.
| Compound Name | 4-(3,4-difluorophenyl)-1-[(1R)-1-phenylethyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 59975359 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1-[(1R)-1-phenylethyl]-1,3-diazinan-2-one |
| SMILES | C[C@H](c1ccccc1)N1CCC(c2ccc(F)c(F)c2)NC1=O |
| InChI | InChI=1S/C18H18F2N2O/c1-12(13-5-3-2-4-6-13)22-10-9-17(21-18(22)23)14-7-8-15(19)16(20)11-14/h2-8,11-12,17H,9-10H2,1H3,(H,21,23)/t12-,17?/m1/s1 |
| InChIKey | AMZACZHEWJNXSW-MTATWXBHSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |