C12H10N4O3 — CID 116980052
2-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)imidazolidine-1-carbonitrile (PubChem CID 116980052) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)imidazolidine-1-carbonitrile.
| Compound Name | 2-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)imidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 116980052 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)imidazolidine-1-carbonitrile |
| SMILES | N#CN1CC(c2ccc3c(c2)NC(=O)CO3)NC1=O |
| InChI | InChI=1S/C12H10N4O3/c13-6-16-4-9(15-12(16)18)7-1-2-10-8(3-7)14-11(17)5-19-10/h1-3,9H,4-5H2,(H,14,17)(H,15,18) |
| InChIKey | UDJWDCBYSNIECV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|