C11H11N3O3 — CID 116855828
6-(2-oxoimidazolidin-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 116855828) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-(2-oxoimidazolidin-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-oxoimidazolidin-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116855828 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 6-(2-oxoimidazolidin-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C3CNC(=O)N3)cc2N1 |
| InChI | InChI=1S/C11H11N3O3/c15-10-5-17-9-2-1-6(3-7(9)13-10)8-4-12-11(16)14-8/h1-3,8H,4-5H2,(H,13,15)(H2,12,14,16) |
| InChIKey | LNJAEVCMKWPMRV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |