C12H13N3O — CID 116980124
2-[4-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile (PubChem CID 116980124) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile.
| Compound Name | 2-[4-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 116980124 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[4-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetonitrile |
| SMILES | Cc1ccc(C2CN(CC#N)C(=O)N2)cc1 |
| InChI | InChI=1S/C12H13N3O/c1-9-2-4-10(5-3-9)11-8-15(7-6-13)12(16)14-11/h2-5,11H,7-8H2,1H3,(H,14,16) |
| InChIKey | VDMCICUSLCAZEV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|