About 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile
2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile (PubChem CID 116980196) has the molecular formula C12H10N4O3
and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile |
| PubChem CID | 116980196 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile |
| SMILES | N#CCN1CC(c2ccc3oc(=O)[nH]c3c2)NC1=O |
| InChI | InChI=1S/C12H10N4O3/c13-3-4-16-6-9(14-11(16)17)7-1-2-10-8(5-7)15-12(18)19-10/h1-2,5,9H,4,6H2,(H,14,17)(H,15,18) |
| InChIKey | WVPVTQAMVRJUIX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile?
The IUPAC name of 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile (CID 116980196) is 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile.
What is the SMILES notation for 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile?
The canonical SMILES for 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile is N#CCN1CC(c2ccc3oc(=O)[nH]c3c2)NC1=O.
What is the InChIKey of 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile?
The InChIKey is WVPVTQAMVRJUIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O3/c13-3-4-16-6-9(14-11(16)17)7-1-2-10-8(5-7)15-12(18)19-10/h1-2,5,9H,4,6H2,(H,14,17)(H,15,18).
What are the key properties of 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile?
2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile has a molecular weight of 258.24 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-4-(2-oxo-3H-1,3-benzoxazol-5-yl)imidazolidin-1-yl]acetonitrile is sourced from PubChem (CID 116980196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).