C15H12N2O3 — CID 116837252
5-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 116837252) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116837252 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-(3,4-dihydro-2H-1,4-benzoxazin-3-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(C3COc4ccccc4N3)ccc2o1 |
| InChI | InChI=1S/C15H12N2O3/c18-15-17-11-7-9(5-6-14(11)20-15)12-8-19-13-4-2-1-3-10(13)16-12/h1-7,12,16H,8H2,(H,17,18) |
| InChIKey | DERJKSPRVMBNDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |