C14H19N3O2 — CID 116962874
5-[1-(2-aminoethyl)piperidin-4-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 116962874) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-[1-(2-aminoethyl)piperidin-4-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[1-(2-aminoethyl)piperidin-4-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116962874 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-[1-(2-aminoethyl)piperidin-4-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | NCCN1CCC(c2ccc3oc(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C14H19N3O2/c15-5-8-17-6-3-10(4-7-17)11-1-2-13-12(9-11)16-14(18)19-13/h1-2,9-10H,3-8,15H2,(H,16,18) |
| InChIKey | IHUQXAZJRCPEMC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |