C10H13N3O2 — CID 115195344
5-[(2-aminoethylamino)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 115195344) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-[(2-aminoethylamino)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(2-aminoethylamino)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115195344 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-[(2-aminoethylamino)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | NCCNCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H13N3O2/c11-3-4-12-6-7-1-2-9-8(5-7)13-10(14)15-9/h1-2,5,12H,3-4,6,11H2,(H,13,14) |
| InChIKey | PCIWTIYOHNBVIB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|