C9H10N2O2S — CID 115227979
5-[(sulfanylmethylamino)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 115227979) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-[(sulfanylmethylamino)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[(sulfanylmethylamino)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115227979 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-[(sulfanylmethylamino)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(CNCS)ccc2o1 |
| InChI | InChI=1S/C9H10N2O2S/c12-9-11-7-3-6(4-10-5-14)1-2-8(7)13-9/h1-3,10,14H,4-5H2,(H,11,12) |
| InChIKey | AMRCASUIXXTMSU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|