C13H17N3O3 — CID 115155445
4-amino-N-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]butanamide (PubChem CID 115155445) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-amino-N-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]butanamide.
| Compound Name | 4-amino-N-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 115155445 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-amino-N-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]butanamide |
| SMILES | NCCCC(=O)NCCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H17N3O3/c14-6-1-2-12(17)15-7-5-9-3-4-11-10(8-9)16-13(18)19-11/h3-4,8H,1-2,5-7,14H2,(H,15,17)(H,16,18) |
| InChIKey | NDVSGVQJICCNMD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |