C22H34N4O2 — CID 170749885
3-[3-[1-(6-aminohexyl)piperidin-4-yl]anilino]piperidine-2,6-dione (PubChem CID 170749885) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-[3-[1-(6-aminohexyl)piperidin-4-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-[1-(6-aminohexyl)piperidin-4-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170749885 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 3-[3-[1-(6-aminohexyl)piperidin-4-yl]anilino]piperidine-2,6-dione |
| SMILES | NCCCCCCN1CCC(c2cccc(NC3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c23-12-3-1-2-4-13-26-14-10-17(11-15-26)18-6-5-7-19(16-18)24-20-8-9-21(27)25-22(20)28/h5-7,16-17,20,24H,1-4,8-15,23H2,(H,25,27,28) |
| InChIKey | CKWVKCNYEHCOSV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|