C22H32N4O3 — CID 162504384
2-(4-tert-butylpiperidin-1-yl)-N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]acetamide (PubChem CID 162504384) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]acetamide.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 162504384 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-N-[3-[(2,6-dioxopiperidin-3-yl)amino]phenyl]acetamide |
| SMILES | CC(C)(C)C1CCN(CC(=O)Nc2cccc(NC3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C22H32N4O3/c1-22(2,3)15-9-11-26(12-10-15)14-20(28)24-17-6-4-5-16(13-17)23-18-7-8-19(27)25-21(18)29/h4-6,13,15,18,23H,7-12,14H2,1-3H3,(H,24,28)(H,25,27,29) |
| InChIKey | BTPIZARXZNCEFQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|